| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 5-tert-Butyl-2-(2,5-dichloro-phenyl)-2H-pyrazol-3-ylamine Basic information |
| Product Name: | 5-tert-Butyl-2-(2,5-dichloro-phenyl)-2H-pyrazol-3-ylamine | | Synonyms: | 3-(tert-Butyl)-1-(2,5-dichlorophenyl)-1H-pyrazol-5-amine;1H-Pyrazol-5-amine, 1-(2,5-dichlorophenyl)-3-(1,1-dimethylethyl)-;JR-13896, 5-Tert-butyl-2-(2,5-dichlorophenyl)-2h-pyrazol-3-ylamine, 97%;5-tert-Butyl-2-(2,5-dichloro-phenyl)-2H-pyrazol-3-ylamine | | CAS: | 1017781-20-2 | | MF: | C13H15Cl2N3 | | MW: | 284.18 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 5-tert-Butyl-2-(2,5-dichloro-phenyl)-2H-pyrazol-3-ylamine Chemical Properties |
| form | solid | | InChI | 1S/C13H15Cl2N3/c1-13(2,3)11-7-12(16)18(17-11)10-6-8(14)4-5-9(10)15/h4-7H,16H2,1-3H3 | | InChIKey | KKZYUJMFCXQJQP-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1cc(N)n(n1)-c2cc(Cl)ccc2Cl |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 5-tert-Butyl-2-(2,5-dichloro-phenyl)-2H-pyrazol-3-ylamine Usage And Synthesis |
| | 5-tert-Butyl-2-(2,5-dichloro-phenyl)-2H-pyrazol-3-ylamine Preparation Products And Raw materials |
|