| Company Name: |
Bhavesh Chem Labs
|
| Tel: |
+91 9182312179 |
| Email: |
pnaresh@bhaveshchemlabs.in |
| Products Intro: |
Product Name:3-TERTBUTYL-1-(2-CHLORO PHENYL)-1H-PYRAZOLE-5-AMINE
CAS:956397-18-5
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
Chemsky（shanghai）International Co.,Ltd.
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:3-tert-Butyl-1-(2-chlorophenyl)-1H-pyrazol-5-aMine
CAS:956397-18-5
Purity:98%+ Package:1500RMB/100MG; 1922RMB/250MG; 3500RMB/1G; 10250RMB/5G
|
| Company Name: |
JW & Y Pharmlab Co., Ltd.
|
| Tel: |
021-64340559 13651849907; |
| Email: |
xinyu_shi@jwypharmlab.com.cn |
| Products Intro: |
Product Name:5-tert-Butyl-2-(2-chloro-phenyl)-2H-pyrazol-3-ylamine
CAS:956397-18-5
Purity:0.96 Package:1g;5g;25g;100g;250g等可分装
|
|
| | 3-TERT-BUTYL-1-(2-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE Basic information |
| Product Name: | 3-TERT-BUTYL-1-(2-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE | | Synonyms: | 5-TERT-BUTYL-2-(2-CHLORO-PHENYL)-2H-PYRAZOL-3-YLAMINE;3-TERT-BUTYL-1-(2-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE;JR-13690, 3-Tert-butyl-1-(2-chlorophenyl)-1H-pyrazol-5-amine, 96%;5-tert-butyl-2-(2-chlorophenyl)pyrazol-3-amine;1H-Pyrazol-5-amine, 1-(2-chlorophenyl)-3-(1,1-dimethylethyl)-;3-TERTBUTYL-1-(2-CHLORO PHENYL)-1H-PYRAZOLE-5-AMINE | | CAS: | 956397-18-5 | | MF: | C13H16ClN3 | | MW: | 249.74 | | EINECS: | | | Product Categories: | | | Mol File: | 956397-18-5.mol |  |
| | 3-TERT-BUTYL-1-(2-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE Chemical Properties |
| Boiling point | 387.2±37.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | form | solid | | pka | 3.52±0.10(Predicted) | | InChI | 1S/C13H16ClN3/c1-13(2,3)11-8-12(15)17(16-11)10-7-5-4-6-9(10)14/h4-8H,15H2,1-3H3 | | InChIKey | AHLRDDKINAAAJO-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1cc(N)n(n1)-c2ccccc2Cl |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-TERT-BUTYL-1-(2-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE Usage And Synthesis |
| | 3-TERT-BUTYL-1-(2-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE Preparation Products And Raw materials |
|