|
|
| | 2-Nitrophenol Sodium Salt Basic information |
| | 2-Nitrophenol Sodium Salt Chemical Properties |
| Boiling point | 215.8° C at 760 mmHg (Predicted) | | refractive index | n20D ~1.61 (Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Red to Dark Red | | InChI | InChI=1S/C6H5NO3.Na.H/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4,8H;; | | InChIKey | RWFPDIBAKOVKMN-UHFFFAOYSA-N | | SMILES | N(C1C=CC=CC=1O)(=O)=O.[NaH] | | CAS DataBase Reference | 824-39-5(CAS DataBase Reference) | | EPA Substance Registry System | o-Nitrophenol sodium salt (824-39-5) |
| RTECS | SM4755000 | | TSCA | TSCA listed | | HS Code | 2908.99.9000 |
| | 2-Nitrophenol Sodium Salt Usage And Synthesis |
| Uses | 2-Nitrophenol sodium salt is a polymer film used in wastewater treatments. It effectively prevents bacterial growth through interactions with the active components within the polymer matrix. 2-Nitrophenol Sodium Salt is also used as a beneficial nutrient solution for potatoes. It exhibits an acidic nature, with a pH range between 3 and 4, enhancing its versatility and utility in various contexts. |
| | 2-Nitrophenol Sodium Salt Preparation Products And Raw materials |
|