4-Vinylbenzyl acetate manufacturers
- 4-Vinylbenzyl acetate
-
- $1.30
-
2026-09-24
- CAS:1592-12-7
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
- 4-vinylbenzyl acetate
-
-
2025-06-04
- CAS:1592-12-7
- Min. Order: 10g
- Purity: 97%+
- Supply Ability: 100000kgs per Month
|
| | 4-Vinylbenzyl acetate Basic information |
| Product Name: | 4-Vinylbenzyl acetate | | Synonyms: | 4-Vinylbenzyl acetate, stabilized, 95%;4-VINYLBENZYL ACETATE STABILIZED 95%;4-Vinylbenzyl acetate, 95%, stabilized;4-Vinylbenzyl acetate, stabilized, 95% 5GR;Vinylbenzyl acetate;Benzenemethanol, 4-ethenyl-, 1-acetate;(4-ethenylphenyl)methyl acetate;4-Vinylbenzyl alcohol acetate | | CAS: | 1592-12-7 | | MF: | C11H12O2 | | MW: | 176.21 | | EINECS: | | | Product Categories: | | | Mol File: | 1592-12-7.mol |  |
| | 4-Vinylbenzyl acetate Chemical Properties |
| Boiling point | 125°C/12mmHg | | density | 1.051 g/cm3(Temp: 25 °C) | | refractive index | 1.535-1.538 | | storage temp. | Sealed in dry,2-8°C | | form | Crystals or Crystalline Powder | | color | White | | InChI | InChI=1S/C11H12O2/c1-3-10-4-6-11(7-5-10)8-13-9(2)12/h3-7H,1,8H2,2H3 | | InChIKey | LEIKPUSDAWATBV-UHFFFAOYSA-N | | SMILES | C1(COC(=O)C)C=CC(C=C)=CC=1 |
| Safety Statements | 24/25 | | HS Code | 29163900 |
| Provider | Language |
|
ACROS
| English |
| | 4-Vinylbenzyl acetate Usage And Synthesis |
| Chemical Properties | clear slightly yellow liquid | | Uses | 4-Vinylbenzyl Acetate is a useful research chemical compound used in the prepaaration of N-trifluoromethylthio-dibenzenesulfonimide. |
| | 4-Vinylbenzyl acetate Preparation Products And Raw materials |
|