| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(Chloromethyl)anthraquinone Basic information |
| | 2-(Chloromethyl)anthraquinone Chemical Properties |
| Melting point | 166-169 °C (lit.) | | form | solid | | BRN | 1975355 | | InChI | 1S/C15H9ClO2/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17/h1-7H,8H2 | | InChIKey | NVUYDKYMEMGYFP-UHFFFAOYSA-N | | SMILES | ClCc1ccc2C(=O)c3ccccc3C(=O)c2c1 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HS Code | 2914790090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-(Chloromethyl)anthraquinone Usage And Synthesis |
| Uses | 2-(Chloromethyl)anthraquinone may be used in the following processes:
- Synthesis of 2-[methylamino-N-(1′-methyl-4′-N,N-diethylaminobutyl)]anthraquinone diphosphate.
- Synthesis of 2-(3,4-dicyano-phenyl)-2-(9,10-dioxo-9,10-dihydroantracen-2-yl-methyl)-malonic acid diethyl ester, starting reagent for the synthesis of tetra substituted metallophthalocyanines.
- To alter the glassy carbon (GC) electrode surface in order to investigate the oxygen reduction reaction (ORR) in alkaline medium.
| | General Description | 2-(Chloromethyl)anthraquinone is an anthraquinone derivative. It was utilized as a substrate to synthesize Cibanone yellow R, a vat dye. Its electrochemical behavior has been studied over a wide pH range. |
| | 2-(Chloromethyl)anthraquinone Preparation Products And Raw materials |
|