|
|
| | cis-11-Octadecenoic acid methyl ester Basic information |
| | cis-11-Octadecenoic acid methyl ester Chemical Properties |
| Boiling point | 136°C/0.2mmHg(lit.) | | density | 0.873±0.06 g/cm3(Predicted) | | refractive index | 1.4500 to 1.4540 | | Fp | 62 °C | | storage temp. | −20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colourless | | BRN | 1911845 | | InChI | 1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h8-9H,3-7,10-18H2,1-2H3/b9-8- | | InChIKey | PVVODBCDJBGMJL-HJWRWDBZSA-N | | SMILES | CCCCCC\C=C/CCCCCCCCCC(=O)OC | | LogP | 8.160 (est) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | RIDADR | UN1206 - class 3 - PG 2 - Heptanes, solution | | WGK Germany | 1 | | F | 8-10-23 | | HS Code | 2916.19.5000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | cis-11-Octadecenoic acid methyl ester Usage And Synthesis |
| Uses | Vaccenic Acid methyl Ester is the methyl ester of Vaccenic Acid (V070000) which is a fatty acid found in Artemia salina that shows antimicrobial activity against a variety of microorganisms except Escherichia coli, Micrococcus luteus and Salmonella enteritidis. |
| | cis-11-Octadecenoic acid methyl ester Preparation Products And Raw materials |
|