- CROCONIC ACID
-
- $7.00 / 1KG
-
2020-01-10
- CAS:488-86-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | CROCONIC ACID Basic information |
| Product Name: | CROCONIC ACID | | Synonyms: | Croconicacid,98%;1,2-Dihydroxycyclopentene-3,4,5-trione;Crocic acid;4,5-Dihydroxy-4-cyclopentene-1,2,3-trione,97%;4-Cyclopentene-1,2,3-trione,4,5-dihydroxy-;4-Cyclopentene-1,2,3-trione;4,5-DIHYDROXY-4-CYCLOPENTENE-1,2,3-TRIONE;4,5-DIHYDROXY-CYCLOPENT-4-ENE-1,2,3-TRIONE | | CAS: | 488-86-8 | | MF: | C5H2O5 | | MW: | 142.07 | | EINECS: | | | Product Categories: | | | Mol File: | 488-86-8.mol |  |
| | CROCONIC ACID Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 291.7°C | | density | 2.3110 | | refractive index | 1.6400 (estimate) | | storage temp. | room temp | | pka | 0.92±0.25(Predicted) | | form | Powder or Crystals | | color | Yellow | | Water Solubility | Soluble in water and ethanol. | | BRN | 2043130 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | InChI=1S/C5H2O5/c6-1-2(7)4(9)5(10)3(1)8/h6-7H | | InChIKey | RBSLJAJQOVYTRQ-UHFFFAOYSA-N | | SMILES | C1(=O)C(O)=C(O)C(=O)C1=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | HS Code | 29144000 | | Storage Class | 11 - Combustible Solids |
| | CROCONIC ACID Usage And Synthesis |
| Chemical Properties | gold-coloured powder | | Uses | Croconic acid is used to prepare 1,3-bis-(2-dimethylamino-5-thienyl)croconine by reacting with dimethyl-thiophen-2-yl-amine. It is also used in organic synthesis and employed as a dye for biological research purposes. Further, it is involved in the preparation of ethers such as dimethyl croconate. In addition to this, it acts as a ligand and form coordination complexes with metals such as barium, copper, silver and lead. |
| | CROCONIC ACID Preparation Products And Raw materials |
|