| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Cyclohexanone-d10 Basic information |
| Product Name: | Cyclohexanone-d10 | | Synonyms: | [2H10]cyclohexanone;CYCLOHEXANONE-D10, 98 ATOM % D;CYCLOHEXANONE-D10 (D, 98%);2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexan-1-one;Cyclohexanone-d??;Cyclohexanone-d10;Cyclohexanone-D?? (D, 98%);Cyclohexanone-d10 | | CAS: | 51209-49-5 | | MF: | C6D10O | | MW: | 108.2 | | EINECS: | 257-058-7 | | Product Categories: | Alphabetical Listings;C;Stable Isotopes | | Mol File: | 51209-49-5.mol |  |
| | Cyclohexanone-d10 Chemical Properties |
| Melting point | -47 °C (lit.) | | Boiling point | 155 °C (lit.) | | density | 1.044 g/mL at 25 °C | | refractive index | n20/D 1.45(lit.) | | Fp | 116 °F | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | Oil | | color | Colourless | | InChI | 1S/C6H10O/c7-6-4-2-1-3-5-6/h1-5H2/i1D2,2D2,3D2,4D2,5D2 | | InChIKey | JHIVVAPYMSGYDF-YXALHFAPSA-N | | SMILES | [2H]C1([2H])C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] | | CAS Number Unlabeled | 108-94-1 |
| Hazard Codes | Xn | | Risk Statements | 10-20 | | Safety Statements | 25 | | RIDADR | UN 1915 3/PG 3 | | WGK Germany | 2 | | HazardClass | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Dam. 1
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | Cyclohexanone-d10 Usage And Synthesis |
| Uses | Cyclohexanone-d10 is the isotope labelled analog of Cyclohexanone (C987980). Cyclohexanone, is an intermediate in the synthesis of CCNU, an effective antitumor agent. |
| | Cyclohexanone-d10 Preparation Products And Raw materials |
|