| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Cyclohexanone-2,2,6,6-d4 Basic information |
| Product Name: | Cyclohexanone-2,2,6,6-d4 | | Synonyms: | Cyclohexanone--d4;Cyclohexanone-2,2,6,6-d4 98 atom % D;Cyclohexanone-2,2,6,6-d?;Methisosildenafil Impurity 71;Cyclohexanone-2,2,6,6-d4;Cyclohexanone (2,2,6,6-D?, 98%);CYCLOEEXANONE-
2,2,6,6-D4;Cyclohexanone-2,2,6,6-d4 | | CAS: | 1006-03-7 | | MF: | C6H6D4O | | MW: | 102.17 | | EINECS: | | | Product Categories: | Alphabetical Listings;C;Stable Isotopes | | Mol File: | 1006-03-7.mol |  |
| | Cyclohexanone-2,2,6,6-d4 Chemical Properties |
| Melting point | -47 °C (lit.) | | Boiling point | 153 °C (lit.) | | density | 0.986 g/mL at 25 °C | | refractive index | n20/D 1.449(lit.) | | Fp | 116 °F | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C6H10O/c7-6-4-2-1-3-5-6/h1-5H2/i4D2,5D2 | | InChIKey | JHIVVAPYMSGYDF-CQOLUAMGSA-N | | SMILES | [2H]C1([2H])CCCC([2H])([2H])C1=O | | CAS Number Unlabeled | 108-94-1 |
| Hazard Codes | Xn | | Risk Statements | 10-20 | | Safety Statements | 23-25 | | RIDADR | UN 1915 3/PG 3 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Dam. 1
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | Cyclohexanone-2,2,6,6-d4 Usage And Synthesis |
| Uses | CYCLOHEXANONE-2,2,6,6-D4 is used as an internal standard for the quantification of Cyclohexanone by GC- or LC-mass spectrometry. |
| | Cyclohexanone-2,2,6,6-d4 Preparation Products And Raw materials |
|