| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Sodium 3-sulfobenzoate Basic information |
| Product Name: | Sodium 3-sulfobenzoate | | Synonyms: | 3-SULFOBENZOIC ACID MONOSODIUM SALT;3-SULFOBENZOIC ACID SODIUM SALT;3-SSBA;3-CARBOXYBENZENESULFONIC ACID SODIUM SALT;3-sulfo-benzoicacimonosodiumsalt;sodium hydrogen m-sulphonatobenzoate;SODIUM 3-SULFONBENZOATE;SODIUM 3-SULFOBENZOATE | | CAS: | 17625-03-5 | | MF: | C7H5O5S.Na | | MW: | 224.17 | | EINECS: | 241-602-5 | | Product Categories: | bc0001 | | Mol File: | 17625-03-5.mol |  |
| | Sodium 3-sulfobenzoate Chemical Properties |
| Melting point | ≥300 °C (lit.) | | Boiling point | 365.41℃[at 101 325 Pa] | | density | 1.792[at 20℃] | | vapor pressure | 0.003Pa at 60℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | water: soluble25mg/mL, clear, colorless | | form | powder to crystal | | color | White to Almost white | | Odor | essentially odorless | | Water Solubility | 100g/L at 20.5℃ | | BRN | 5675222 | | InChI | InChI=1S/C7H6O5S.Na/c8-7(9)5-2-1-3-6(4-5)13(10,11)12;/h1-4H,(H,8,9)(H,10,11,12);/q;+1/p-1 | | InChIKey | KQHKITXZJDOIOD-UHFFFAOYSA-M | | SMILES | C1(S([O-])(=O)=O)C=CC=C(C(=O)O)C=1.[Na+] | | LogP | 0.3 at 25℃ | | CAS DataBase Reference | 17625-03-5(CAS DataBase Reference) | | EPA Substance Registry System | 3-Sulfobenzoic acid monosodium salt (17625-03-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2916.39.7900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Sodium 3-sulfobenzoate Usage And Synthesis |
| Chemical Properties | White fine crystalline powder | | Uses | Sodium 3-Sulfobenzoate is used as a reagent in the synthesis of imidazolium poly(butylene terephthalate) ionomers which can exhibit long-term antimicrobial activity even after six days. | | General Description | Sodium 3-sulfobenzoate is the sodium salt of 3-sulfobenzoic acid. Steady state method has been proposed for the evaluation of solubility of its binary solvent mixtures at high temperatures. | | Flammability and Explosibility | Not classified |
| | Sodium 3-sulfobenzoate Preparation Products And Raw materials |
|