| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(-)-6,6'-Dibromo-1,1'-bi-2-naphthol Basic information | | Reactions |
| Product Name: | (R)-(-)-6,6'-Dibromo-1,1'-bi-2-naphthol | | Synonyms: | 6'-DIBROMO-1,1'-BI-2-NAPHTHOL;(+/-)-6,6'-DIBROMO-2,2'-DIHYDROXY-1,1'-BINAPHTHYL;(+/-)-6,6'-DIBROMO-1,1'-BI-2-NAPHTHOL;(R)-(-)-6,6'-Dibromo-1,1'-bi-2-naphthol,min.98%;(R)-(-)-6,6''-DIBROMO-1,1''-BI-2-NAPHTOL;AURORA KA-7214;(S)-(+)-6'-DIBROMO-1,1'-BI-2-NAPHTHOL;(S)-(+)-6,6'-DIBROMO-2,2'-DIHYDROXY-1,1'-BINAPHTHYL | | CAS: | 65283-60-5 | | MF: | C20H12Br2O2 | | MW: | 444.12 | | EINECS: | | | Product Categories: | BINOL Series;Chiral Oxygen;Chiral Compound;BINOLs;Chiral Catalysts, Ligands, and Reagents;Privileged Ligands and Complexes;Asymmetric Synthesis;Synthetic Organic Chemistry;chiral | | Mol File: | 65283-60-5.mol |  |
| | (R)-(-)-6,6'-Dibromo-1,1'-bi-2-naphthol Chemical Properties |
| Melting point | 195-199 °C(lit.) | | Boiling point | 546.2±45.0 °C(Predicted) | | alpha | -48 º (c=1.8, THF) | | density | 1.5428 (rough estimate) | | refractive index | 1.4947 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | Water Solubility | Insoluble in water | | pka | 7.78±0.50(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | Optical Rotation | [α]20/D 49°, c = 1.8 in acetic acid | | InChI | 1S/C20H12Br2O2/c21-13-3-5-15-11(9-13)1-7-17(23)19(15)20-16-6-4-14(22)10-12(16)2-8-18(20)24/h1-10,23-24H | | InChIKey | OORIFUHRGQKYEV-UHFFFAOYSA-N | | SMILES | Brc1cc2c(c(c(cc2)O)c3c4c(cc(cc4)Br)ccc3O)cc1 | | CAS DataBase Reference | 65283-60-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 29081990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-(-)-6,6'-Dibromo-1,1'-bi-2-naphthol Usage And Synthesis |
| Reactions |
- Ligand used to prepare a chiral zirconium catalyst useful in asymmetric Strecker and Mannich-type reactions.
- Ligand used for titanium-catalyzed enantioselective Friedel-Crafts reactions.
| | Chemical Properties | white to light yellow crystal powde |
| | (R)-(-)-6,6'-Dibromo-1,1'-bi-2-naphthol Preparation Products And Raw materials |
|