| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Naphthol as-bi beta-D-glucuronide Basic information |
| Product Name: | Naphthol as-bi beta-D-glucuronide | | Synonyms: | O-BETA-D-GLUCORONOSYL-NAPHTHOL AS-BI;O-BETA-D-GLUCURONOSYL-NAPHTHOL AS-BI;NAPHTHOL AS-BI BETA-D-GLUCOSIDURONIC ACID;NAPHTHOL AS-BI BETA-D-GLUCURONIC ACID;NAPHTHOL AS-BI-BETA-D-GLUCURONIDE, FOR H ISTOLOGY;NaphtholAB-BIbeta-D-glucuronide;Naphthol-AS-BI-b-D-glucuronide;naphthol as-bi β-d-glucuronide | | CAS: | 37-87-6 | | MF: | C24H22BrNO9 | | MW: | 548.34 | | EINECS: | 1533716-785-6 | | Product Categories: | substrate;Substrates | | Mol File: | 37-87-6.mol |  |
| | Naphthol as-bi beta-D-glucuronide Chemical Properties |
| Boiling point | 736.3±60.0 °C(Predicted) | | density | 1.695±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | NH4OH 1 M: 20 mg/mL, clear, faintly yellow | | form | powder to crystal | | pka | 2.74±0.70(Predicted) | | color | White to Almost white | | BRN | 6883214 | | InChIKey | ACOOAEDFQKSZTC-NABGWTBKSA-N | | SMILES | COc1ccccc1NC(=O)c2cc3cc(Br)ccc3cc2O[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | Naphthol as-bi beta-D-glucuronide Usage And Synthesis |
| Chemical Properties | White to cream cryst powder | | Uses | Naphthol AS-BI β-D-glucuronide (cas# 37-87-6) is a carbohydrate with anti-bacterial and anti-biofilm properties. Naphthol AS-BI β-D-glucuronide has been used to study the transport of glucuronides across the endoplasmic reticulum in rat liver microsomes. | | Definition | ChEBI: 2-naphthol AS BI-beta-D-glucuronide is a beta-D-glucosiduronic acid having a 6-bromo-3-[(2-methoxyphenyl)carbamoyl]naphthalen-2-yl substituent at the anomeric position. It has a role as a chromogenic compound. It is a beta-D-glucosiduronic acid, an organobromine compound, a naphthalenecarboxamide and an aromatic ether. |
| | Naphthol as-bi beta-D-glucuronide Preparation Products And Raw materials |
|