| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Homatropine hydrochloride manufacturers
|
| | Homatropine hydrochloride Basic information |
| Product Name: | Homatropine hydrochloride | | Synonyms: | homatropineHCl;Homatropinhydrochlorid;(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2-phenylacetate hydrochloride;(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2-phenyl-ethanoate hydrochloride;2-hydroxy-2-phenyl-acetic acid (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) ester hydrochloride;HomatropineHydrochloride>(1R,3r,5S)-8-methyl-8-azabicyclo[3.2.1]Octan-3-yl 2-hydroxy-2-phenylacetate hydrochloride;(1R,5S)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl hydroxy(phenyl)acetate hydrochloride | | CAS: | 637-21-8 | | MF: | C16H22ClNO3 | | MW: | 311.8 | | EINECS: | 211-280-0 | | Product Categories: | Biochemistry;Tropane Alkaloids;Alkaloids | | Mol File: | 637-21-8.mol |  |
| | Homatropine hydrochloride Chemical Properties |
| Melting point | 226 °C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Base (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Merck | 14,4730 | | InChI | InChI=1S/C4H3ClF4O2/c1-11-2(10)3(6,7)4(5,8)9/h1H3 | | InChIKey | FRMDDIJBLQNNTC-RDYJJYPNSA-N | | SMILES | Cl.N1([C@@H]2C[C@H](C[C@H]1CC2)OC(=O)C(O)c3ccccc3)C | | CAS DataBase Reference | 637-21-8 |
| RIDADR | UN 1544 6.1/PG III | | WGK Germany | WGK 3 | | HS Code | 2939.79.0000 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids |
| | Homatropine hydrochloride Usage And Synthesis |
| Uses | Homatropine hydrochloride is an orally active anticholinergic agent that rapidly dilates pupils and has cycloplegic effects. Homatropine hydrochloride also has antitussive activity. Homatropine hydrochloride can be used in research on eye diseases and coughs[1]. | | References | [1] Gore A, et al. Efficacy assessment of various anticholinergic agents against topical sarin-induced miosis and visual impairment in rats. Toxicol Sci. 2012 Apr;126(2):515-24. DOI:10.1093/toxsci/kfs009 |
| | Homatropine hydrochloride Preparation Products And Raw materials |
|