2-(5-BROMO-2-PYRIDYLAZO)-5-(DIETHYLAMINO)PHENOL manufacturers
|
| | 2-(5-BROMO-2-PYRIDYLAZO)-5-(DIETHYLAMINO)PHENOL Basic information |
| | 2-(5-BROMO-2-PYRIDYLAZO)-5-(DIETHYLAMINO)PHENOL Chemical Properties |
| Melting point | 155-160 °C | | Boiling point | 511.1±50.0 °C(Predicted) | | density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 8.56±0.40(Predicted) | | form | Crystalline Powder | | color | Red | | λmax | 443 nm | | BRN | 430511 | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | InChI=1S/C15H17BrN4O/c1-3-20(4-2)12-6-7-13(14(21)9-12)18-19-15-8-5-11(16)10-17-15/h5-10,21H,3-4H2,1-2H3 | | InChIKey | HNVCXDAVEHOIBP-VHEBQXMUSA-N | | SMILES | C1(O)=CC(N(CC)CC)=CC=C1N=NC1=NC=C(Br)C=C1 | | CAS DataBase Reference | 14337-53-2(CAS DataBase Reference) |
| Safety Statements | 24/25-22 | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | 2-(5-BROMO-2-PYRIDYLAZO)-5-(DIETHYLAMINO)PHENOL Usage And Synthesis |
| Chemical Properties | RED CRYSTALLINE POWDER | | Uses | 2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol is used in the spectrophotometric flow injection assay for the determination of trace amount of thiocyanate level in saliva from smokers and non-smokers, also in the spectrophotometric investigation of sensitive complexing agents for the determination of zinc in serum. Dyes and metabolites. |
| | 2-(5-BROMO-2-PYRIDYLAZO)-5-(DIETHYLAMINO)PHENOL Preparation Products And Raw materials |
|