| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester manufacturers
|
| | 4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester Basic information |
| Product Name: | 4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester | | Synonyms: | 2-[4-Chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzotrifluoride;2-(4-chloro-3-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 2-[4-chloro-3-(trifluoroMethyl)phenyl]-4,4,5,5-tetraMethyl-;4-Chloro-3-trifluoromethylphenylboronic acid,pinacol;4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester | | CAS: | 445303-09-3 | | MF: | C13H15BClF3O2 | | MW: | 306.52 | | EINECS: | | | Product Categories: | Aryl;Organoborons;Trifluoromethyl | | Mol File: | 445303-09-3.mol |  |
| | 4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester Chemical Properties |
| Boiling point | 327.1±42.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C13H15BClF3O2/c1-11(2)12(3,4)20-14(19-11)8-5-6-10(15)9(7-8)13(16,17)18/h5-7H,1-4H3 | | InChIKey | VBNMWVUQPRYIIM-UHFFFAOYSA-N | | SMILES | ClC1=C(C(F)(F)F)C=C(B2OC(C)(C)C(C)(C)O2)C=C1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester Usage And Synthesis |
| | 4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester Preparation Products And Raw materials |
|