- alpha-Adenosine
-
- $1049.00
-
2026-05-11
- CAS:5682-25-7
- Purity:
- Supply Ability: 10g
|
| | 9-alpha-Ribofuranosyladenine Basic information |
| Product Name: | 9-alpha-Ribofuranosyladenine | | Synonyms: | ALPHA-ADENOSINE;A-ADENOSINE FREE BASE;9-α-ribofuranosyladenine;9-α-Ribofuranosyladenine, 9-(α-D-Ribofuranosyl)adenine;alpha-D-Adenosine;9-alpha-d-ribofuranosyl-9h-purin-6-amin;Ribavirin Impurity 62 (alfa-Adenosine);9H-Purin-6-amine, 9-α-D-ribofuranosyl- | | CAS: | 5682-25-7 | | MF: | C10H13N5O4 | | MW: | 267.24 | | EINECS: | | | Product Categories: | Pharm intermediate;API;Intermediates | | Mol File: | 5682-25-7.mol |  |
| | 9-alpha-Ribofuranosyladenine Chemical Properties |
| Melting point | 205-207 °C(lit.) | | storage temp. | −20°C | | form | Solid | | color | Off-white to light yellow | | InChI | InChI=1/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10+/s3 | | InChIKey | OIRDTQYFTABQOQ-MLVNPOJINA-N | | SMILES | N1(C=NC2C(N)=NC=NC1=2)[C@@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 |&1:10,11,13,15,r| |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | - |
| | 9-alpha-Ribofuranosyladenine Usage And Synthesis |
| Uses | 9-α-Adenosine is an intermediate in the proposed R&D synthesis of 2,3,5-Tri-O-acetyl α-Adenosine (T733805), an Adenosine (A280400(P)) impurity. |
| | 9-alpha-Ribofuranosyladenine Preparation Products And Raw materials |
|