|
|
| | Vidarabine monophosphate Basic information |
| Product Name: | Vidarabine monophosphate | | Synonyms: | 9H-Purin-6-amine,9-(5-O-phosphono-b-D-arabinofuranosyl)-;9-BETA-D-ARABINOFURANOSYLADENINE-5'-MONOPHOSPHATE;9-BETA-D-ARABINOFURANOSYL-ADENINE-5'-MONOPHOSPHORIC ACID;9-BETA-D-ARABINOFURANOSYLADENINE MONOPHOSPHATE;9-(5-O-PHOSPHONO-BETA-D-ARABINOFURANOSYL)-9H-PURIN-6-AMINE;ADENINE-9-BETA-D-ARABINOFURANOSIDE-5'-MONOPHOSPHATE;ADENINE-BETA-D-ARABINOFURANOSIDE-5'-PHOSPHATE;5’-arabinosyladeninemonophosphate | | CAS: | 29984-33-6 | | MF: | C10H14N5O7P | | MW: | 347.22 | | EINECS: | 249-990-8 | | Product Categories: | 29984-33-6 | | Mol File: | 29984-33-6.mol |  |
| | Vidarabine monophosphate Chemical Properties |
| Melting point | 213 °C | | Boiling point | 798.5±70.0 °C(Predicted) | | density | 2.32±0.1 g/cm3(Predicted) | | storage temp. | Store at 0°C | | form | Powder | | pka | 1.86±0.10(Predicted) | | color | White to Off-white | | Water Solubility | Soluble in water at 4mg/ml | | InChI | InChI=1/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7+,10-/s3 | | InChIKey | UDMBCSSLTHHNCD-GCTRTDOSNA-N | | SMILES | O[C@H]1[C@@H]([C@@H](COP(O)(O)=O)O[C@H]1N1C=NC2C(=NC=NC1=2)N)O |&1:1,2,3,11,r| |
| | Vidarabine monophosphate Usage And Synthesis |
| Description | Vidarabine monophosphate, chemical name:
9-(5-O-Phosphono-beta-D-arabinofuranosyl)adenine is an anti
deoxyribonucleic acid virus drug. IVidarabine triphosphate directly
inhibits DNA polymerase and also acts as a chain terminator in DNA
replication. An adenosine monophosphate analog in which ribose is
replaced by an arabinose moiety. It is the monophosphate ester of
VIDARABINE with antiviral and possibly antineoplastic properties. | | Chemical Properties | Crystalline | | Uses | Antiviral. | | Uses | Disrupts viral DNA synthesis. Competitive viral DNA polymerase inhibitor. Active against herpes simplex and varicella zoster viruses in vivo. | | Application | Vidarabine monophosphate has broad-spectrum anti-virus effect and can inhibit a variety of DNA
viruses. It is mainly used to treat chronic hepatitis B and other viral
infections, such as herpes zoster, herpes simplex and genital herpes.
It has quick effect and clear curative effect. It is a common drug for
clinical anti-virus treatment. | | Safety Profile | Moderately toxic byintraperitoneal route. When heated to decomposition itemits very toxic fumes of POx and NOx. |
| | Vidarabine monophosphate Preparation Products And Raw materials |
|