|
|
| | DIMETHYL 3-METHYLGLUTACONATE Basic information |
| Product Name: | DIMETHYL 3-METHYLGLUTACONATE | | Synonyms: | DIMETHYL 3-METHYLGLUTACONATE;2-Pentenedioic acid, 3-methyl-, dimethyl ester;Dimethyl (2E)-2-methyl-2-pentenedioate;dimethyl 3-methylglutaconate, mixture of ci;Dimethyl 3-methylglutaconate,mixture of cis and trans;dimethyl 3-methylpent-2-enedioate;DIMETHYL 3-METHYLGLUTACONATE, 95%, MIXTU RE OF CIS AND TRANS;3-Methyl-2-pentenedioic acid dimethyl ester | | CAS: | 52313-87-8 | | MF: | C8H12O4 | | MW: | 172.18 | | EINECS: | 257-839-2 | | Product Categories: | C8 to C9;Carbonyl Compounds;Esters | | Mol File: | 52313-87-8.mol |  |
| | DIMETHYL 3-METHYLGLUTACONATE Chemical Properties |
| Boiling point | 109-110 °C12 mm Hg(lit.) | | density | 1.095 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.456(lit.) | | Fp | 208 °F | | storage temp. | 2-8°C | | solubility | Chloroform, Methanol | | form | Oil | | color | Clear Colourless to Pale Yellow | | InChI | InChI=1S/C8H12O4/c1-6(4-7(9)11-2)5-8(10)12-3/h4H,5H2,1-3H3 | | InChIKey | GBQBEQOEGMZCOH-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C=C(C)CC(OC)=O |
| | DIMETHYL 3-METHYLGLUTACONATE Usage And Synthesis |
| Uses | Dimethyl 3-Methylglutaconate are shown to induce oxidative damage on striatum and the liver in rats. Also used in the preparation of insect growth regulators with juvenile hormone activity. |
| | DIMETHYL 3-METHYLGLUTACONATE Preparation Products And Raw materials |
|