| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Pentamethyl cyclopentadiene-1,2,3,4,5-pentacarboxylate Basic information |
| Product Name: | Pentamethyl cyclopentadiene-1,2,3,4,5-pentacarboxylate | | Synonyms: | 1,2,3,4,5-pentakis(methoxycarbonyl)cyclopenta-1,3-diene;cyclopenta-1,3-diene-1,2,3,4,5-pentacarboxylic acid pentamethyl ester;Pentakis(methoxycarbonyl)cyclopentadiene;pentamethyl cyclopentadiene-1,2,3,4,5-pentacarbox;Pentamethyl cyclopebtadiene-1,2,3,4,5-pentacarboxylate;1,3-Cyclopentadiene-1,2,3,4,5-pentacarboxylic acid, 1,2,3,4,5-pentamethyl ester;Pentamethyl cyclopenta-1,3-diene-1,2,3,4,5-pentacarboxylate;Pentamethyl cyclopentadiene-1,2,3,4,5-pentacarboxylate | | CAS: | 16691-59-1 | | MF: | C15H16O10 | | MW: | 356.28 | | EINECS: | | | Product Categories: | C12 to C63;Carbonyl Compounds;Esters | | Mol File: | 16691-59-1.mol |  |
| | Pentamethyl cyclopentadiene-1,2,3,4,5-pentacarboxylate Chemical Properties |
| Melting point | 149 °C (dec.) (lit.) | | Boiling point | 451.9±45.0 °C(Predicted) | | density | 1.395±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C15H16O10/c1-21-11(16)6-7(12(17)22-2)9(14(19)24-4)10(15(20)25-5)8(6)13(18)23-3/h6H,1-5H3 | | InChIKey | NJNIOTQAGXGMFK-UHFFFAOYSA-N | | SMILES | COC(=O)C1C(C(=O)OC)=C(C(=O)OC)C(C(=O)OC)=C1C(=O)OC |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Pentamethyl cyclopentadiene-1,2,3,4,5-pentacarboxylate Usage And Synthesis |
| Uses | Useful synthetic building block demonstrated by Tristan Lambert to enable access to chiral Brnsted acid catalysts. |
| | Pentamethyl cyclopentadiene-1,2,3,4,5-pentacarboxylate Preparation Products And Raw materials |
|