- 2-Fluoroanisole
-
-
2026-03-20
- CAS:321-28-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
- 2-Fluoroanisole
-
- $10.00
-
2022-02-25
- CAS:321-28-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10Tons
|
| | 2-Fluoroanisole Basic information |
| | 2-Fluoroanisole Chemical Properties |
| Melting point | −39 °C(lit.) | | Boiling point | 154-155 °C(lit.) | | density | 1.124 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.494(lit.) | | Fp | 140 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Soluble), Methanol (Sparingly) | | form | clear liquid | | Specific Gravity | 1.124 | | color | Colorless to Light yellow to Light orange | | BRN | 1859755 | | InChI | InChI=1S/C7H7FO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 | | InChIKey | JIXDOBAQOWOUPA-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC=C1OC | | CAS DataBase Reference | 321-28-8(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-fluoro-2-methoxy-(321-28-8) |
| Hazard Codes | F,Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-36/37/39-27-26 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29093090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 2-Fluoroanisole Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 2-Fluoroanisole is a useful synthetic intermediate with antifungal activity. | | Synthesis Reference(s) | Chemistry Letters, 23, p. 1011, 1994 Tetrahedron, 52, p. 23, 1996 DOI: 10.1016/0040-4020(95)00867-8 |
| | 2-Fluoroanisole Preparation Products And Raw materials |
|