|
|
| | D-Mannosamine hydrochloride Basic information |
| | D-Mannosamine hydrochloride Chemical Properties |
| Melting point | 168 °C (dec.)(lit.) | | storage temp. | 2-8°C | | solubility | H2O: 0.1 g/mL, clear, colorless | | form | Powder | | color | White to Off-white | | biological source | crab (shell) shrimp shells | | Water Solubility | Soluble in water and methanol. | | Sensitive | Hygroscopic | | BRN | 3914860 | | InChI | InChI=1/C6H13NO5.ClH/c7-3-5(10)4(9)2(1-8)12-6(3)11;/h2-6,8-11H,1,7H2;1H/t2-,3+,4-,5-,6;/s3 | | InChIKey | QKPLRMLTKYXDST-OHXGPSCHSA-N | | SMILES | [C@H]1(CO)OC([C@@H](N)[C@@H](O)[C@@H]1O)O.Cl |&1:0,5,7,9,r| | | CAS DataBase Reference | 5505-63-5(CAS DataBase Reference) | | EPA Substance Registry System | D-Mannose, 2-amino-2-deoxy-, hydrochloride (5505-63-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | F | 3-10 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29329985 | | Storage Class | 11 - Combustible Solids |
| | D-Mannosamine hydrochloride Usage And Synthesis |
| Chemical Properties | D-Mannosamine hydrochloride is White Crystalline Solid | | Uses | D-Mannosamine hydrochloride is a pharmaceutical compound used in the development of mannosylated liposomes for bioadhesive oral drug delivery via M cells of Peyer's patches. | | Uses | D-Mannosamine hydrochloride is used in the synthesis of non-natural Mannac analogs for the expression of thiols on cell-surface sialic acids. It is also used to investigate and screening of N-acetyl-beta-hexosaminidase inhibitor libraries targeting osteoarthritis. It acts as a precursor of N-propanoyl mannosamine and other N-acyl precursors of sialic acid (N-acyl neuraminic acids). It is a pharmaceutical compound used in the development of mannosylated liposomes for bioadhesive oral drug delivery through M cells of Peyer's patches. | | Uses | D-Mannosamine hydrochloride can be used for the synthesis of non-natural ManNAc analogs for the expression of thiols on cell-surface sialic acids. It has been used in a study to investigate the synthesis and high-throughput screening of N-acetyl-β-hexosaminidase inhibitor libraries targeting osteoarthritis. |
| | D-Mannosamine hydrochloride Preparation Products And Raw materials |
|