|
|
| | (+)-ISOPULEGOL Basic information |
| Product Name: | (+)-ISOPULEGOL | | Synonyms: | (1S,2R,5S)-2-ISOPROPENYL-5-METHYLCYCLOHEXANOL;(1S,3S,4R)-P-MENTH-8-EN-3-OL;terpenestandard;(1S,2R,5S)-5-Methyl-2-(prop-1-en-2-yl)cyclohexanol;(1S,3S,4R)-p-Menth-8-en-3-ol, (1S,2R,5S)-2-Isopropenyl-5-methylcyclohexanol;Cyclohexanol,5-methyl-2-(1-methylethenyl)-, (1S,2R,5S)-;(1S,2R,5S)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;(+)-Isopulegol | | CAS: | 104870-56-6 | | MF: | C10H18O | | MW: | 154.25 | | EINECS: | | | Product Categories: | | | Mol File: | 104870-56-6.mol |  |
| | (+)-ISOPULEGOL Chemical Properties |
| Boiling point | 91 °C12 mm Hg(lit.) | | density | 0.912 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.469(lit.) | | Fp | 172 °F | | storage temp. | Store at -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 15.11±0.60(Predicted) | | form | liquid | | Optical Rotation | [α]20/D +22°, neat | | BRN | 4659691 | | Major Application | food and beverages | | InChI | 1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m0/s1 | | InChIKey | ZYTMANIQRDEHIO-AEJSXWLSSA-N | | SMILES | C[C@H]1CC[C@@H]([C@@H](O)C1)C(C)=C |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | F | 10-23 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (+)-ISOPULEGOL Usage And Synthesis |
| Uses | (+)-Isopulegol is a useful biochemical for research studies on terpenoids. A terpenoid with other numerous medical applications. | | Uses | (+)-Isopulegol can be used as a starting material to synthesize:
- A natural product ()-isopiperitenone.
- Medicinally important octahydro-2H-chromen-4-ol derivatives by reacting with benzaldehydes.
- Antituberculosis diterpenoid named 12-epi-ileabethoxazole.
| | General Description | Isopulegol is a monoterpene alcohol, which is generally found in essential oils of various plants. It is widely used as a fragrance ingredient in cosmetics, shampoos and toilet soaps. Isopulegol is also a key intermediate in the synthesis of ()-menthol. |
| | (+)-ISOPULEGOL Preparation Products And Raw materials |
|