| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,2-Dichlorohexafluorocyclopentene Basic information |
| Product Name: | 1,2-Dichlorohexafluorocyclopentene | | Synonyms: | FC-C-1416, 1,2-Dichloro-3,3,4,4,5,5-hexafluorocyclopent-1-ene, 1,2-Dichlorohexafluorocyclopent-1-ene, 1,2-Dichlorohexafluorocyclopentene-1;1,2-dichloro-3,3,4,4,5,5-hexafluoro-cyclopentene;1,2-dichlorohexafluoro-cyclopenten;1,2-Dichloroperfluorocyclopentene;Cyclopentene, 1,2-dichlorohexafluoro-;Cyclopentene,1,2-dichloro-3,3,4,4,5,5-hexafluoro-;cyclopentene-26;Hexafluoro-1,2-Dichloro-1-Cy | | CAS: | 706-79-6 | | MF: | C5Cl2F6 | | MW: | 244.95 | | EINECS: | 211-895-4 | | Product Categories: | Alkenyl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Alkenyl;Halogenated Hydrocarbons;Organic Building Blocks;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks | | Mol File: | 706-79-6.mol |  |
| | 1,2-Dichlorohexafluorocyclopentene Chemical Properties |
| Melting point | -105.8 °C | | Boiling point | 90 °C (lit.) | | density | 1.635 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.37(lit.) | | Fp | >230 °F | | form | liquid | | color | Clear | | BRN | 2053012 | | InChI | 1S/C5Cl2F6/c6-1-2(7)4(10,11)5(12,13)3(1,8)9 | | InChIKey | ABPBVCKGWWGZDP-UHFFFAOYSA-N | | SMILES | FC1(F)C(Cl)=C(Cl)C(F)(F)C1(F)F | | CAS DataBase Reference | 706-79-6(CAS DataBase Reference) | | EPA Substance Registry System | Cyclopentene, 1,2-dichloro-3,3,4,4,5,5-hexafluoro- (706-79-6) |
| Hazard Codes | T,Xi | | Risk Statements | 22-23-36/37/38 | | Safety Statements | 26-36-45 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | RTECS | GY5976200 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2903898090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2-Dichlorohexafluorocyclopentene Usage And Synthesis |
| Uses | 1,2-Dichlorohexafluorocyclopentene may be used to synthesize:
- diarylperfluorocyclopentenes
- fluoro-bisthienylcyclopentenes (F-BTCs)
- 1,1-dichlorooctafluorocyclopentane
- 1,2-dichlorooctafluorocyclopentane
| | General Description | 1,2-Dichlorohexafluorocyclopentene is a halogenated cyclopentene derivative. |
| | 1,2-Dichlorohexafluorocyclopentene Preparation Products And Raw materials |
|