- 4-CYCLOPROPYLANILINE
-
- $1.00
-
2020-01-10
- CAS:3158-71-2
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 200kgs
|
| | 4-CYCLOPROPYLANILINE Basic information |
| Product Name: | 4-CYCLOPROPYLANILINE | | Synonyms: | 4-CYCLOPROPYLANILINE;AKOS BAR-1181;BENZENAMINE, 4-CYCLOPROPYL-;UKRORGSYN-BB BBV-181867;4-Cyclopropylbenzenamine;4-Cyclopropyl-phenylamine;4-cyclopropylaniline(WXC08386);4-Cylclopropylaniline | | CAS: | 3158-71-2 | | MF: | C9H11N | | MW: | 133.19 | | EINECS: | | | Product Categories: | amine | | Mol File: | 3158-71-2.mol |  |
| | 4-CYCLOPROPYLANILINE Chemical Properties |
| Melting point | 36℃ | | Boiling point | 108℃ (10 Torr) | | density | 1.112±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.5811 (589.3 nm 20℃) | | Fp | 108.2±9.3℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 4.82±0.10(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C9H11N/c10-9-5-3-8(4-6-9)7-1-2-7/h3-7H,1-2,10H2 | | InChIKey | UBXDNWVNEZBDBN-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C2CC2)C=C1 |
| | 4-CYCLOPROPYLANILINE Usage And Synthesis |
| | 4-CYCLOPROPYLANILINE Preparation Products And Raw materials |
|