| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
- NPPB
-
- $50.00
-
2026-07-14
- CAS:107254-86-4
- Purity: 99.95%
- Supply Ability: 10g
|
| Product Name: | NPPB | | Synonyms: | 5-NITRO-2-(3'-PHENYLPROPYL-AMINO)BENZOIC ACID;NPPB;5-NITRO-2-(3-PHENYLPROPYLAMINO)BENZOIC A CID POTENT CHLORIDE CHANN;5-NITRO-2-(3-PHENYLPROPYLAMINO)-BENZOIC ACID 98%;3-Nitro-6-[(3-phenylpropyl)amino]benzoic acid;Compound 144;C13705;5-Nitro-2-(3-phenylpropylamino)benzoic acid,NPPB | | CAS: | 107254-86-4 | | MF: | C16H16N2O4 | | MW: | 300.31 | | EINECS: | | | Product Categories: | Chloride channel | | Mol File: | 107254-86-4.mol |  |
| Melting point | 178-180℃ | | Boiling point | 523.5±50.0 °C(Predicted) | | density | 1.323±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | ethanol: 3 mg/mL | | form | Yellow solid | | pka | 2.27±0.22(Predicted) | | color | Light yellow to yellow | | InChI | 1S/C16H16N2O4/c19-16(20)14-11-13(18(21)22)8-9-15(14)17-10-4-7-12-5-2-1-3-6-12/h1-3,5-6,8-9,11,17H,4,7,10H2,(H,19,20) | | InChIKey | WBSMIPAMAXNXFS-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(ccc1NCCCc2ccccc2)[N+]([O-])=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| Uses | Biochemical probe primarily as a Cl- channel blocker. | | Uses | NPPB is a chloride channel blocker and acts as a GPR35 agonist. It maintains protonophoric activity and has been used to uncouple mitochondrial ATP synthesis in phagocytes. | | Definition | ChEBI: 5-Nitro-2-(3-phenylpropylamino)benzoic acid is a nitrobenzoic acid. | | Biological Activity | Very potent chloride channel blocker. | | Biochem/physiol Actions | Potent chloride channel blocker. | | storage | Store at RT |
| | NPPB Preparation Products And Raw materials |
|