|
|
| | 1-BOC-2,3-DIHYDRO-7-INDOLECARBALDEHYDE Basic information |
| Product Name: | 1-BOC-2,3-DIHYDRO-7-INDOLECARBALDEHYDE | | Synonyms: | 1-BOC-2,3-DIHYDRO-7-INDOLECARBALDEHYDE;tert-butyl 7-formyl-2,3-dihydro-1H-indole-1-carboxylate;tert-Butyl 7-formylindoline-1-carboxylate in stock Factory;N-BOC-INDOLINE-7-CARBOXALDEHYDE;N-Boc 7-formylindoline;N-BOC-2,3-dihydro-7-indolecarbalehyde;tert-butyl 7-forMylindoline-1-carboxylate;1-(tert-Butoxycarbonyl)indoline-7-carboxaldehyde | | CAS: | 174539-67-4 | | MF: | C14H17NO3 | | MW: | 247.29 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 174539-67-4.mol |  |
| | 1-BOC-2,3-DIHYDRO-7-INDOLECARBALDEHYDE Chemical Properties |
| Melting point | 86-90 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | InChI | 1S/C14H17NO3/c1-14(2,3)18-13(17)15-8-7-10-5-4-6-11(9-16)12(10)15/h4-6,9H,7-8H2,1-3H3 | | InChIKey | KUYIMEZLCAWOMI-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1cccc2CCN(C(=O)OC(C)(C)C)c12 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral |
| | 1-BOC-2,3-DIHYDRO-7-INDOLECARBALDEHYDE Usage And Synthesis |
| Uses | Useful bi-functional starter in indoline chemistry and natural product chemistry |
| | 1-BOC-2,3-DIHYDRO-7-INDOLECARBALDEHYDE Preparation Products And Raw materials |
|