|
|
| | 2-Boc-amino-benzaldehyde Basic information | | Uses |
| Product Name: | 2-Boc-amino-benzaldehyde | | Synonyms: | (2-FORMYL-PHENYL)-CARBAMIC ACID TERT-BUTYL ESTER;tert-butyl2-formylphenylcarbamate;2-(Boc-amino)benzaldehyde 97%;Carbamic acid, N-(2-formylphenyl)-, 1,1-dimethylethyl ester;1,1-Dimethylethyl N-(2-formylphenyl)carbamate;2-Boc-amino-benzaldehyde | | CAS: | 74965-38-1 | | MF: | C12H15NO3 | | MW: | 221.25 | | EINECS: | | | Product Categories: | | | Mol File: | 74965-38-1.mol |  |
| | 2-Boc-amino-benzaldehyde Chemical Properties |
| Melting point | 57-61°C | | Boiling point | 291.7±23.0 °C(Predicted) | | density | 1.163±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 13.35±0.70(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C12H15NO3/c1-12(2,3)16-11(15)13-10-7-5-4-6-9(10)8-14/h4-8H,1-3H3,(H,13,15) | | InChIKey | DHALMIBUKCNMLD-UHFFFAOYSA-N | | SMILES | [H]C(C1=C(NC(OC(C)(C)C)=O)C=CC=C1)=O |
| Hazard Codes | Xn | | Risk Statements | 22-43 | | Safety Statements | 36/37-61 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Skin Sens. 1 |
| | 2-Boc-amino-benzaldehyde Usage And Synthesis |
| Uses | N-BOC-2-formylaniline is an amine organic compound that can be used as a pharmaceutical intermediate. |
| | 2-Boc-amino-benzaldehyde Preparation Products And Raw materials |
|