|
|
| | SN-38 GLUCURONIDE Basic information |
| Product Name: | SN-38 GLUCURONIDE | | Synonyms: | SN-38 GLUCURONIDE;(4S)-4,11-Diethyl-3,4,12,14-tetrahydro-4-hydroxy-3,14-dioxo-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinolin-9-yl β-D-Glucopyranosiduronic Acid;4,11-Diethyl-3,4,12,14-tetrahydro-4-hydroxy-3,14-dioxo-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinolin-9-yl β-D-Glucopyranosiduronic Acid;SN-38-d5 Glucuronide;β-D-Glucopyranosiduronic acid, (4S)-4,11-diethyl-3,4,12,14-tetrahydro-4-hydroxy-3,14-dioxo-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinolin-9-yl;SN38 13C6 glucuronide;b-D-Glucopyranosiduronic acid,(4S)-4,11-diethyl-3,4,12,14-tetrahydro-4-hydroxy-3,14-dioxo-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinolin-9-yl;Irinotecan Impurity 38 | | CAS: | 121080-63-5 | | MF: | C28H28N2O11 | | MW: | 568.53 | | EINECS: | | | Product Categories: | Chiral Reagents;Glucuronides;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 121080-63-5.mol |  |
| | SN-38 GLUCURONIDE Chemical Properties |
| Melting point | >250°C (dec.) | | Boiling point | 1019.7±65.0 °C(Predicted) | | density | 1.67±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.72±0.70(Predicted) | | color | White to Yellow | | Stability: | Hygroscopic | | InChIKey | SSJQVDUAKDRWTA-NMHCCGJVNA-N | | SMILES | C12=NC3=C(C=C(O[C@H]4[C@H](O)[C@H]([C@H](O)[C@@H](C(=O)O)O4)O)C=C3)C(CC)=C1CN1C(=O)C3COC(=O)[C@](O)(CC)C=3C=C21 |&1:7,8,10,11,13,34,r| |
| | SN-38 GLUCURONIDE Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | A metabolite of Irinotecan | | Definition | ChEBI: SN38 glucuronide is a pyranoindolizinoquinoline. |
| | SN-38 GLUCURONIDE Preparation Products And Raw materials |
|