|
|
| | 3,4-DIFLUOROPHENYLACETYLENE Basic information |
| Product Name: | 3,4-DIFLUOROPHENYLACETYLENE | | Synonyms: | 3,4-Difluorophenylacetylene95%;1,2-Difluoro-4-ethynylbenzene;3,4-Difluoro-1-ethynylbenzene;Benzene, 4-ethynyl-1,2-difluoro-;3,4-DIFLUOROPHENYLACETYLENE;4-ETHYNYL-1,2-DIFLUORO-BENZENE;Benzene, 4-ethynyl-1,2-difluoro- (9CI);3,4-difluorobenzeneacetylene | | CAS: | 143874-13-9 | | MF: | C8H4F2 | | MW: | 138.11 | | EINECS: | | | Product Categories: | Aromatics | | Mol File: | 143874-13-9.mol |  |
| | 3,4-DIFLUOROPHENYLACETYLENE Chemical Properties |
| Boiling point | 54/2mm | | density | 1.144 g/mL at 25 °C | | refractive index | 1.4902 | | Fp | 7 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C8H4F2/c1-2-6-3-4-7(9)8(10)5-6/h1,3-5H | | InChIKey | XFPAOXIWRDDQGG-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(C#C)C=C1F |
| Hazard Codes | F | | Risk Statements | 11 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable | | HazardClass | 3 | | HS Code | 2902900000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | 3,4-DIFLUOROPHENYLACETYLENE Usage And Synthesis |
| Uses | 3,4-DIFLUOROPHENYLACETYLENE is a fundamental building block used in organic synthesis for the preparation of metalated and metal-free tetraalkynyl-substituted phthalocyanines, and 3,5-substituted enones etc. |
| | 3,4-DIFLUOROPHENYLACETYLENE Preparation Products And Raw materials |
|