|
|
| | 3,4,5-Trifluorophenylacetylene Basic information |
| Product Name: | 3,4,5-Trifluorophenylacetylene | | Synonyms: | 5-ETHYNYL-1,2,3-TRIFLUORO-BENZENE;Benzene, 5-ethynyl-1,2,3-trifluoro- (9CI);Benzene, 5-ethynyl-1,2,3-trifluoro-;3,4,5-Trifluorophenylacetylen;5-Ethynyl-1,2,3-trifluorobenzene >;3,4,5-Trifluorophenylacetylene | | CAS: | 158816-55-8 | | MF: | C8H3F3 | | MW: | 156.1 | | EINECS: | | | Product Categories: | HALIDE | | Mol File: | 158816-55-8.mol |  |
| | 3,4,5-Trifluorophenylacetylene Chemical Properties |
| Boiling point | 53-54/1mm | | density | 1.27±0.1 g/cm3(Predicted) | | refractive index | 1.4720 to 1.4760 | | storage temp. | Store at room temperature | | form | clear liquid | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C8H3F3/c1-2-5-3-6(9)8(11)7(10)4-5/h1,3-4H | | InChIKey | BZXWRVPVZZZAKB-UHFFFAOYSA-N | | SMILES | C1(F)=CC(C#C)=CC(F)=C1F |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 1993 3/PG III | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2903998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3,4,5-Trifluorophenylacetylene Usage And Synthesis |
| | 3,4,5-Trifluorophenylacetylene Preparation Products And Raw materials |
|