| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | ISO-OMPA Basic information |
| Product Name: | ISO-OMPA | | Synonyms: | ISO-OMPA;tetraisopropylpyrophosphamide;Diphosphoramide, N,N,N,N-tetrakis(1-methylethyl)-;iso-OMPA, Tetra(monoisopropyl)pyrophosphortetramide;Dipropyldiphosphoramide;Oxybis[bis(isopropylamino)phosphine oxide];[bis(isopropylamino)phosphoryloxy-(isopropylamino)phosphoryl]-isopropyl-amine;N-[bis(propan-2-ylamino)phosphoryloxy-(propan-2-ylamino)phosphoryl]propan-2-amine | | CAS: | 513-00-8 | | MF: | C12H32N4O3P2 | | MW: | 342.36 | | EINECS: | 208-149-5 | | Product Categories: | | | Mol File: | 513-00-8.mol |  |
| | ISO-OMPA Chemical Properties |
| Melting point | 151 °C(Solv: acetone (67-64-1)) | | Boiling point | 396.7±25.0 °C(Predicted) | | density | 1.076±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 1.22±0.70(Predicted) | | form | Solid | | color | White to off-white | | biological source | synthetic | | InChI | 1S/C12H32N4O3P2/c1-9(2)13-20(17,14-10(3)4)19-21(18,15-11(5)6)16-12(7)8/h9-12H,1-8H3,(H2,13,14,17)(H2,15,16,18) | | InChIKey | IOIMDJXKIMCMIG-UHFFFAOYSA-N | | SMILES | CC(C)NP(=O)(NC(C)C)OP(=O)(NC(C)C)NC(C)C | | EPA Substance Registry System | Diphosphoramide, N,N',N'',N'''-tetrakis(1-methylethyl)- (513-00-8) |
| Hazard Codes | T+ | | Risk Statements | 26/27/28 | | Safety Statements | 22-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 1 | | WGK Germany | 3 | | Storage Class | 6.1B - Non-combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral |
| | ISO-OMPA Usage And Synthesis |
| Uses | Tetraisopropyl pyrophosphoramide has been used:
- as a butyrylcholinesterase inhibitor to determine the proportions of butyrylcholinesterase (BChE) in cat and tiger plasma
- to inhibit wild-type BChE in acetylcholinesterase assay
- to selectively block the enzymatic activity of AChE
| | Definition | ChEBI: Diphosphoramide, N,N',N'',N'''-tetrakis(1-methylethyl)- is a phosphoramide. | | Biochem/physiol Actions | Selective inhibitor of butyrylcholinesterase | | in vivo | Iso-OMPA (0.6-1.9 mg/kg, subcutaneous injection, single dose) enhances soman toxicity in rats but has no effect on mice[3]. | Animal Model: | Mouse and rat[3] | | Dosage: | 0.6, 1.9 mg/kg; single dose | | Administration: | Subcutaneous injection (s.c.) | | Result: | Caused rat plasma CarbE activity to be only slightly inhibited by lower doses and significantly inhibited by higher doses. CarbE activity in mice was not inhibited. |
| | IC 50 | BuChE |
| | ISO-OMPA Preparation Products And Raw materials |
|