| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
2-(2,5-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid manufacturers
|
| | 2-(2,5-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Basic information |
| | 2-(2,5-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Chemical Properties |
| Boiling point | 547.5±60.0 °C(Predicted) | | density | 1.393±0.06 g/cm3(Predicted) | | pka | 3.32±0.20(Predicted) | | form | solid | | InChI | 1S/C17H13NO4/c1-9-3-4-10(2)14(7-9)18-15(19)12-6-5-11(17(21)22)8-13(12)16(18)20/h3-8H,1-2H3,(H,21,22) | | InChIKey | SIWXMKDPCUAHIK-UHFFFAOYSA-N | | SMILES | N2(C(=O)c3c(ccc(c3)C(=O)O)C2=O)c1c(ccc(c1)C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(2,5-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Usage And Synthesis |
| | 2-(2,5-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Preparation Products And Raw materials |
|