| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(2,3-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Basic information |
| Product Name: | 2-(2,3-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid | | Synonyms: | CHEMBRDG-BB 5186766;2-(2,3-DIMETHYLPHENYL)-1,3-DIOXOISOINDOLINE-5-CARBOXYLIC ACID;AKOS BBS-00009184;OTAVA-BB 7015151011;1H-isoindole-5-carboxylic acid, 2-(2,3-dimethylphenyl)-2,3;2-(2,3-dimethylphenyl)-1,3-dioxoisoindoline-5-carboxylic acid(SALTDATA: FREE);2-(2,3-dimethylphenyl)-1,3-diketo-isoindoline-5-carboxylic acid;2-(2,3-dimethylphenyl)-1,3-dioxo-isoindole-5-carboxylic acid | | CAS: | 294667-08-6 | | MF: | C17H13NO4 | | MW: | 295.29 | | EINECS: | | | Product Categories: | | | Mol File: | 294667-08-6.mol |  |
| | 2-(2,3-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Chemical Properties |
| Boiling point | 553.9±60.0 °C(Predicted) | | density | 1.393±0.06 g/cm3(Predicted) | | pka | 3.32±0.20(Predicted) | | form | solid | | InChI | 1S/C17H13NO4/c1-9-4-3-5-14(10(9)2)18-15(19)12-7-6-11(17(21)22)8-13(12)16(18)20/h3-8H,1-2H3,(H,21,22) | | InChIKey | OHGUIZGDCCILFX-UHFFFAOYSA-N | | SMILES | N2(C(=O)c3c(ccc(c3)C(=O)O)C2=O)c1c(c(ccc1)C)C |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 2-(2,3-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Usage And Synthesis |
| | 2-(2,3-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Preparation Products And Raw materials |
|