Monochlorobimane manufacturers
|
| | Monochlorobimane Basic information |
| | Monochlorobimane Chemical Properties |
| Melting point | 135-136 °C(lit.) | | Boiling point | 314.9±44.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMF: soluble | | pka | -3.22±0.70(Predicted) | | form | Solid | | color | Light yellow to yellow | | Appearance | Solid Powder | | ex/em | λex 395 nm; λem 489 nm | | BRN | 4440901 | | InChI | InChI=1S/C10H11ClN2O2/c1-5-7(3)12-8(4-11)6(2)10(15)13(12)9(5)14/h4H2,1-3H3 | | InChIKey | SUIPVTCEECPFIB-UHFFFAOYSA-N | | SMILES | N12C(C)=C(C)C(=O)N1C(=O)C(C)=C2CCl |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Monochlorobimane Usage And Synthesis |
| Description | ChlorobimaneMonochlorobimane is a thiol-reactive, non-ionic fluorescent probe. | | Uses | Cell-permeant probe for quantifying glutathione levels in cells. Generally suitable for the detection of thiol groups. | | Uses | Chlorobimane is a thiol-reactive fluorescent probe used for measuring glutathione levels in cells. | | Definition | ChEBI: Monochlorobimane is an organochlorine compound and a pyrazolopyrazole. It has a role as a fluorochrome. |
| | Monochlorobimane Preparation Products And Raw materials |
|