| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
Norepinephrine Tartrate Impurity 2 manufacturers
|
| | Norepinephrine Tartrate Impurity 2 Basic information |
| Product Name: | Norepinephrine Tartrate Impurity 2 | | Synonyms: | Norepinephrine Tartrate Impurity 2;Norepinephrine Impurity 12;Benzenemethanesulfonic acid, α-(aminomethyl)-3,4-dihydroxy-;Noradrenaline bitartrate impurity II;2-amino-1-(3,4-dihydroxyphenyl)ethanesulfonic acid;Norepinephrine Sulfonic Acid(Norepinephrine CP impurity II);2-Amino-1-(3,4-dihydroxyphenyl)ethane-1-sulfonic acid;2-amino-1-(3,4-dihydroxyphenyl)ethane-1-sulfonic acidChemical Formula: C8H11NO5S | | CAS: | 24159-36-2 | | MF: | C8H11NO5S | | MW: | 233.24 | | EINECS: | | | Product Categories: | XHL | | Mol File: | 24159-36-2.mol |  |
| | Norepinephrine Tartrate Impurity 2 Chemical Properties |
| solubility | DMSO (Slightly, Heated), Water (Slightly, Heated) | | form | Solid | | color | Pale Red to Grey | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H11NO3.C4H6O6/c9-4-8(12)5-1-2-6(10)7(11)3-5;5-1(3(7)8)2(6)4(9)10/h1-3,8,10-12H,4,9H2;1-2,5-6H,(H,7,8)(H,9,10) | | InChIKey | WNPNNLQNNJQYFA-UHFFFAOYSA-N | | SMILES | OC1=C(O)C=CC(C(CN)O)=C1.C(O)(=O)C(C(C(O)=O)O)O |
| | Norepinephrine Tartrate Impurity 2 Usage And Synthesis |
| Uses | Norepinephrine Sulfonic Acid is a derivative of DL-Norepinephrine Hydrochloride (N674500), antagonist of dibutyryl cyclic-AMP in the regulation of narcosis. Norepinephrine modulates human dendritic cell activation by altering cytokine release. |
| | Norepinephrine Tartrate Impurity 2 Preparation Products And Raw materials |
|