|
|
| | Metaraminol bitartrate Basic information |
| Product Name: | Metaraminol bitartrate | | Synonyms: | (-)-M-HYDROXYPHENYLPROPANOLAMINE BITARTRATE SALT;(-)-alpha-(1-aminoethyl)-m-hydroxybenzylalcoholbitartrate;metraminolbitartrate;pressonexbitartrate;Aramine (sympathomimetic);Benzenemethanol, a-(1-aminoethyl)-3-hydroxy-, [R-(R*,S*)]-, [R-(R*,R*)]-2,3-dihydroxybutanedioate (1:1) (salt);Benzenemethanol, a-[(1S)-1-aminoethyl]-3-hydroxy-, (aR)-, (2R,3R)-2,3-dihydroxybutanedioate (1:1) (salt) (9CI);Benzyl alcohol, a-(1-aminoethyl)-m-hydroxy-, (-)-, tartrate (1:1) (salt) (8CI) | | CAS: | 33402-03-8 | | MF: | C13H19NO8 | | MW: | 317.29 | | EINECS: | 251-502-3 | | Product Categories: | API;DELAVAN;33402-03-8 | | Mol File: | 33402-03-8.mol |  |
| | Metaraminol bitartrate Chemical Properties |
| Melting point | 176-177° | | storage temp. | Store at -20°C | | solubility | DMSO:0.0(Max Conc. mg/mL);0.0(Max Conc. mM) | | form | A solid | | color | White to off-white | | Stability: | Toxic | | InChI | InChI=1S/C9H13NO2.C4H6O6/c1-6(10)9(12)7-3-2-4-8(11)5-7;5-1(3(7)8)2(6)4(9)10/h2-6,9,11-12H,10H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t6-,9-;1-,2-/m01/s1 | | InChIKey | VENXSELNXQXCNT-IJYXXVHRSA-N | | SMILES | [C@H](O)(C(=O)O)[C@@H](O)C(=O)O.[C@H](C1C=CC=C(C=1)O)(O)[C@@H](N)C | | CAS DataBase Reference | 33402-03-8(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 23/24/25 | | Safety Statements | 26-28-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | DN5160000 | | HS Code | 2939800000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral |
| | Metaraminol bitartrate Usage And Synthesis |
| Chemical Properties | Colourless solid | | Uses | antiinfective | | Brand name | Aramine (Merck)
. | | Biological Activity | α-adrenoceptor agonist.
Metaraminol may serve as a false sympathetic transmitter. It is a mixed α - and β-adrenergic agonist. |
| | Metaraminol bitartrate Preparation Products And Raw materials |
|