|
|
| | Ethyl cyclobutanecarboxylate Basic information |
| | Ethyl cyclobutanecarboxylate Chemical Properties |
| Boiling point | 159 °C (lit.) | | density | 0.928 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.426(lit.) | | Fp | 107 °F | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 1929653 | | InChI | InChI=1S/C7H12O2/c1-2-9-7(8)6-4-3-5-6/h6H,2-5H2,1H3 | | InChIKey | SMVBADCAMQOTOV-UHFFFAOYSA-N | | SMILES | C1(C(OCC)=O)CCC1 | | CAS DataBase Reference | 14924-53-9(CAS DataBase Reference) | | NIST Chemistry Reference | Ethyl cyclobutanecarboxylate(14924-53-9) |
| Risk Statements | 10 | | Safety Statements | 16-24/25 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29162090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | Ethyl cyclobutanecarboxylate Usage And Synthesis |
| Uses | Ethyl cyclobutanecarboxylate can be used in the synthesis of cyclobutylidenecyclopropane by a three-step sequence. | | Synthesis Reference(s) | Tetrahedron Letters, 8, p. 215, 1967 DOI: 10.1016/S0040-4039(00)90519-7 |
| | Ethyl cyclobutanecarboxylate Preparation Products And Raw materials |
|