| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(Fluorosulfonyl)benzoyl chloride Basic information |
| | 4-(Fluorosulfonyl)benzoyl chloride Chemical Properties |
| Melting point | 46-48 °C (lit.) | | Boiling point | 96-97 °C/0.7 mmHg (lit.) | | density | 1.5278 (estimate) | | Stability: | Stable, but hydrolyzes in water to generate acidic gas which can react with metals (and thereby generate flammable hydrogen gas). Incompatible with water, alcohols, strong bases, oxidizing agents. | | InChI | 1S/C7H4ClFO3S/c8-7(10)5-1-3-6(4-2-5)13(9,11)12/h1-4H | | InChIKey | JMTAYFNTRRLWQG-UHFFFAOYSA-N | | SMILES | FS(=O)(=O)c1ccc(cc1)C(Cl)=O |
| Hazard Codes | C | | Risk Statements | 34-36/37-22 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| | 4-(Fluorosulfonyl)benzoyl chloride Usage And Synthesis |
| Chemical Properties | solid | | Uses | 4-(Fluorosulfonyl)benzoyl chloride was used as reagent in the synthesis of irreversible adenosine A1 antagonist 8-cyclopentyl-3-N-[3-((3-(4-fluorosulphonyl)benzoyl)-oxy)-propyl]-1-N-propyl-xanthine. | | reaction suitability | reaction type: click chemistry |
| | 4-(Fluorosulfonyl)benzoyl chloride Preparation Products And Raw materials |
|