| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Oleic acid-1-13C Basic information |
| Product Name: | Oleic acid-1-13C | | Synonyms: | [(Z)-18-[1,3-bis[[(Z)-12-sulfonatooxyoctadec-9-enoyl]oxy]propan-2-yloxy]-18-oxooctadec-9-en-7-yl] sulfate;Epa pesticide chemical code 079014;C18 Unsaturataftty Acid;18:1;9C-OCTADECENOIC ACID-1-13C;9-OCTADECENOIC ACID (1-13C);9-OCTADECANOIC ACID;C18:1 (CIS-9) ACID | | CAS: | 8051-88-5 | | MF: | C18H34O2 | | MW: | 283.47 | | EINECS: | 617-105-8 | | Product Categories: | Unsaturated Fatty Acids 13C & 2H | | Mol File: | Mol File |  |
| | Oleic acid-1-13C Chemical Properties |
| Melting point | 13-14 °C(lit.) | | Boiling point | 194-195 °C1.2 mm Hg(lit.) | | density | 0.893 g/mL at 25 °C | | vapor pressure | 1 mm Hg ( 176 °C) | | refractive index | n20/D 1.4595(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | H2O: 50 mg/mL, may be clear to slightly hazy | | form | powder | | biological source | synthetic (organic) | | Water Solubility | H2O: 50mg/mL, clear to slightly hazy | | InChI | 1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- | | InChIKey | ZQPPMHVWECSIRJ-KTKRTIGZSA-N | | SMILES | CCCCCCCC\C=C/CCCCCCCC(O)=O |
| Hazard Codes | Xi | | Risk Statements | 38-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | RG2275000 | | F | 8-10-23 | | Storage Class | 10 - Combustible liquids |
| | Oleic acid-1-13C Usage And Synthesis |
| Uses | Oleic Acid-Water Soluble has been used:
- to prepare the FFAs (free fatty acids) mixture for cell treatment
- to investigate its effect on the solute carrier family 2 member 4 (SLC2A4)/GLUT4 expression in L6 muscle cells and as potential transcriptional regulators
- in the preparation of fatting media for the induction of in vitro steatosis in primary human hepatocytes
| | Definition | A salt or ester of oleic
acid; i.e. an octadecenoate. | | Definition | oleate: A salt or ester of oleic acid. |
| | Oleic acid-1-13C Preparation Products And Raw materials |
|