| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
|
| | Lifitegrast Impurity 3 Basic information |
| Product Name: | Lifitegrast Impurity 3 | | Synonyms: | methyl (S)-2-(2-(benzofuran-6-carbonyl)-5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carboxamido)-3-(3-(methylsulfonyl)phenyl)propanoate;(S)-methyl 2-(2-(benzofuran-6-carbonyl);Lifitegrast Impurity GQ: What is
Lifitegrast Impurity G Q: What is the CAS Number of
Lifitegrast Impurity G Q: What is the storage condition of
Lifitegrast Impurity G;Lifitegrast Impurity 35;L-Phenylalanine, N-[[2-(6-benzofuranylcarbonyl)-5,7-dichloro-1,2,3,4-tetrahydro-6-isoquinolinyl]carbonyl]-3-(methylsulfonyl)-, methyl ester | | CAS: | 2295862-29-0 | | MF: | C30H26Cl2N2O7S | | MW: | 629.51 | | EINECS: | | | Product Categories: | | | Mol File: | 2295862-29-0.mol |  |
| | Lifitegrast Impurity 3 Chemical Properties |
| Boiling point | 789.4±60.0 °C(Predicted) | | density | 1.426±0.06 g/cm3(Predicted) | | pka | 11.19±0.20(Predicted) | | InChIKey | XZMRMQMDMACEHK-DEOSSOPVSA-N | | SMILES | C(OC)(=O)[C@H](CC1=CC=CC(S(C)(=O)=O)=C1)NC(C1C(Cl)=CC2=C(C=1Cl)CCN(C(C1C=C3OC=CC3=CC=1)=O)C2)=O |
| | Lifitegrast Impurity 3 Usage And Synthesis |
| | Lifitegrast Impurity 3 Preparation Products And Raw materials |
|