| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:N-(4-Nitrophenyl)forMaMide CAS:16135-31-2 Purity:97% Package:1G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:N-(4-Nitrophenyl)formamide CAS:16135-31-2 Purity:97% Remarks:B36590
|
|
| | N-(4-NITROPHENYL)FORMAMIDE 97 Basic information |
| | N-(4-NITROPHENYL)FORMAMIDE 97 Chemical Properties |
| Melting point | 196-200 °C (lit.) | | form | solid | | InChI | 1S/C7H6N2O3/c10-5-8-6-1-3-7(4-2-6)9(11)12/h1-5H,(H,8,10) | | InChIKey | ZTCQFVRINYOPOH-UHFFFAOYSA-N | | SMILES | [H]C(=O)Nc1ccc(cc1)[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 42/43 | | Safety Statements | 36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | N-(4-NITROPHENYL)FORMAMIDE 97 Usage And Synthesis |
| | N-(4-NITROPHENYL)FORMAMIDE 97 Preparation Products And Raw materials |
|