| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(4-Bromophenoxy)benzoic acid 97 Basic information |
| | 4-(4-Bromophenoxy)benzoic acid 97 Chemical Properties |
| Melting point | 187-190 °C | | Boiling point | 407.0±25.0 °C(Predicted) | | density | 1.553±0.06 g/cm3(Predicted) | | pka | 4.27±0.10(Predicted) | | form | solid | | InChI | 1S/C13H9BrO3/c14-10-3-7-12(8-4-10)17-11-5-1-9(2-6-11)13(15)16/h1-8H,(H,15,16) | | InChIKey | GQZGWHFUVISZQO-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(Oc2ccc(Br)cc2)cc1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-36-43-50/53 | | Safety Statements | 26-36/37-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Sens. 1 |
| | 4-(4-Bromophenoxy)benzoic acid 97 Usage And Synthesis |
| | 4-(4-Bromophenoxy)benzoic acid 97 Preparation Products And Raw materials |
|