| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | 4-(4-Bromophenoxy)benzaldehyde 97 Basic information |
| | 4-(4-Bromophenoxy)benzaldehyde 97 Chemical Properties |
| Melting point | 69-73 °C | | Boiling point | 189°C/2.5mmHg(lit.) | | density | 1.475±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Orange to Green | | Sensitive | Air Sensitive | | InChI | 1S/C13H9BrO2/c14-11-3-7-13(8-4-11)16-12-5-1-10(9-15)2-6-12/h1-9H | | InChIKey | WMDDJOBNAOVSLP-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(Oc2ccc(Br)cc2)cc1 |
| Hazard Codes | Xi,N | | Risk Statements | 41-43-51/53 | | Safety Statements | 26-36/39-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | HazardClass | 9 | | HS Code | 2913000090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Sens. 1 |
| | 4-(4-Bromophenoxy)benzaldehyde 97 Usage And Synthesis |
| | 4-(4-Bromophenoxy)benzaldehyde 97 Preparation Products And Raw materials |
|