| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5 6-Methylenedioxy-1-indanone 97 Basic information |
| Product Name: | 5 6-Methylenedioxy-1-indanone 97 | | Synonyms: | Nsc65075;5,6-Methylenedioxy-1-indanone 97%;5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one;5H-Indeno[5,6-d]-1,3-dioxol-5-one, 6,7-dihydro-;(S)-2-amino-3-(4-(methoxycarbonyl)phenyl)propanoic acid;3-(benzo[d][1,3]dioxol-5-yl)propanoic acid;5 6-Methylenedioxy-1-indanone 97 | | CAS: | 6412-87-9 | | MF: | C10H8O3 | | MW: | 176.17 | | EINECS: | | | Product Categories: | | | Mol File: | 6412-87-9.mol |  |
| | 5 6-Methylenedioxy-1-indanone 97 Chemical Properties |
| Melting point | 162-166 °C | | Boiling point | 344.9±42.0 °C(Predicted) | | density | 1.395±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | Appearance | Light brown to khaki Solid | | InChI | InChI=1S/C10H8O3/c11-8-2-1-6-3-9-10(4-7(6)8)13-5-12-9/h3-4H,1-2,5H2 | | InChIKey | LKLNTTMWFRNYLE-UHFFFAOYSA-N | | SMILES | O1C2=CC3=C(C=C2OC1)C(=O)CC3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 2 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5 6-Methylenedioxy-1-indanone 97 Usage And Synthesis |
| | 5 6-Methylenedioxy-1-indanone 97 Preparation Products And Raw materials |
|