| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Bis(4-tert-butylphenyl)iodonium p-toluen Basic information |
| | Bis(4-tert-butylphenyl)iodonium p-toluen Chemical Properties |
| Melting point | 237-240 °C (lit.) | | solubility | PGMEA: <1% | | Sensitive | Light Sensitive | | λmax | 202 nm | | InChI | 1S/C20H26I.C7H8O3S/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;1-6-2-4-7(5-3-6)11(8,9)10/h7-14H,1-6H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 | | InChIKey | UEJFJTOGXLEPIV-UHFFFAOYSA-M | | SMILES | Cc1ccc(cc1)S([O-])(=O)=O.CC(C)(C)c2ccc([I+]c3ccc(cc3)C(C)(C)C)cc2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Bis(4-tert-butylphenyl)iodonium p-toluen Usage And Synthesis |
| Uses | Cationic photoinitiator. Photoacid generator. |
| | Bis(4-tert-butylphenyl)iodonium p-toluen Preparation Products And Raw materials |
|