|
|
| | Bis(4-tert-butylphenyl)iodonium hexafluorophosphate Basic information |
| | Bis(4-tert-butylphenyl)iodonium hexafluorophosphate Chemical Properties |
| Melting point | 174 °C | | density | 1.57g/cm3 at 21℃ | | vapor pressure | 0Pa at 25℃ | | solubility | soluble in Ethanol | | form | powder to crystal | | color | White to Almost white | | BRN | 5721061 | | InChI | InChI=1S/C20H26I.F6P/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;1-7(2,3,4,5)6/h7-14H,1-6H3;/q+1;-1 | | InChIKey | CJLLNCQWBHTSCB-UHFFFAOYSA-N | | SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].C(C1C=CC([I+]C2C=CC(C(C)(C)C)=CC=2)=CC=1)(C)(C)C | | LogP | 1.38 at 22℃ and pH6.8 |
| Hazard Codes | C | | Risk Statements | 36/37/38-34 | | Safety Statements | 26-36-45-36/37/39 | | RIDADR | UN 1759 8 / PGIII | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Bis(4-tert-butylphenyl)iodonium hexafluorophosphate Usage And Synthesis |
| Uses | Bis(4-(tert-butyl)phenyl)iodonium hexafluorophosphate(V) is an organic catalyst used for the photoinduced thermal polymerization reactions. |
| | Bis(4-tert-butylphenyl)iodonium hexafluorophosphate Preparation Products And Raw materials |
|