|
|
| | Bis-(4-tert-butylphenyl)-iodonium hexafluoroantimonate Basic information |
| Product Name: | Bis-(4-tert-butylphenyl)-iodonium hexafluoroantimonate | | Synonyms: | Iodonium,bis[4-(1,1-dimethylethyl)phenyl]-,(OC-6-11)-hexafluoroantimonate(1-)(1:1);Bis-(4-tert-butylphenyl)-iodonium hexafluoroantimonate;4,4'-Di-tert-butyldiphenyliodonium hexafluoroantimonate;BBI 103;Bis(4-t-butyl phenyl)iodonium hexafluoroantimonate;Bis(4-tert-butylphenyl)iodine hexafluoroantimonate | | CAS: | 61358-23-4 | | MF: | C20H26I.SbF6 | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 61358-23-4.mol |  |
| | Bis-(4-tert-butylphenyl)-iodonium hexafluoroantimonate Chemical Properties |
| Melting point | 175 °C | | storage temp. | Store under inert gas, Room Temperature (Recommended in a cool and dark place, <15°C) | | form | powder to crystal | | color | White to Light yellow | | Sensitive | Light Sensitive,Hygroscopic | | InChI | InChI=1S/C20H26I.6FH.Sb/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;;;;;;;/h7-14H,1-6H3;6*1H;/q+1;;;;;;;+5/p-6 | | InChIKey | FLZWISWRDNWLPR-UHFFFAOYSA-H | | SMILES | [I+](C1=CC=C(C(C)(C)C)C=C1)C1=CC=C(C(C)(C)C)C=C1.[Sb-](F)(F)(F)(F)(F)F |
| | Bis-(4-tert-butylphenyl)-iodonium hexafluoroantimonate Usage And Synthesis |
| Chemical Properties | White to Light yellow powder to crystal | | Uses | Bis(4-tert-butylphenyl)iodonium Hexafluoroantimonate is a fluorinated metal-organic salt compound whose derivatives (BBI-Tf and BBI-Nf) can be used as photo acid generators. |
| | Bis-(4-tert-butylphenyl)-iodonium hexafluoroantimonate Preparation Products And Raw materials |
|