| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | QUININONE (50 MG) Basic information |
| Product Name: | QUININONE (50 MG) | | Synonyms: | QUININONE (50 MG);(8alpha)-6'-methoxycinchonan-9-one;(8α)-6'-Methoxycinchonan-9-one;(5-ethenyl-1-azabicyclo[2.2.2]octan-7-yl)-(6-methoxyquinolin-4-yl)methanone;(6-methoxy-4-quinolyl)-(5-vinylquinuclidin-2-yl)methanone;Quininone (Quinine Sulfate IMpurity);Quininoe;Cinchonan-9-one, 6'-methoxy-, (8α)- | | CAS: | 84-31-1 | | MF: | C20H22N2O2 | | MW: | 322.4 | | EINECS: | 201-524-4 | | Product Categories: | | | Mol File: | 84-31-1.mol |  |
| | QUININONE (50 MG) Chemical Properties |
| Melting point | 108° (rapid heating) | | alpha | D20 +76° (c = 2 in alcohol) | | Boiling point | 461.02°C (rough estimate) | | density | 1.1478 (rough estimate) | | refractive index | 1.5700 (estimate) | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Beige | | Water Solubility | 3mg/L(20 ºC) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C20H22N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19H,1,7,9-10,12H2,2H3 | | InChIKey | SRFCUPVBYYAMIL-UHFFFAOYSA-N | | SMILES | N21C(CC(C(C2)C=C)CC1)C(=O)c3c4c(ncc3)ccc(c4)OC |
| WGK Germany | WGK 3 | | HS Code | 2939200050 | | Storage Class | 11 - Combustible Solids |
| | QUININONE (50 MG) Usage And Synthesis |
| Uses | Quininone has been shown to have antimalarial activity in mice. Quininone has been shown to aid the binding of drug-induced antibodies to human platelets. |
| | QUININONE (50 MG) Preparation Products And Raw materials |
|