| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N-Trityl-L-homoserine triethylamine salt Basic information |
| Product Name: | N-Trityl-L-homoserine triethylamine salt | | Synonyms: | N-Trityl-L-homoserin-Triethylammonium-Salz;N-Trityl-L-hoMoserine triethylaMine salt,>=98.0%;N,N-diethylethanamine,(2S)-4-hydroxy-2-(tritylamino)butanoicaci;N,N-diethylethanamine,(2S)-4-hydroxy-2-(tritylamino)butanoic acid;N-Trityl-L-homoserine triethylamine salt | | CAS: | 102056-97-3 | | MF: | C29H38N2O3 | | MW: | 462.63 | | EINECS: | | | Product Categories: | | | Mol File: | 102056-97-3.mol |  |
| | N-Trityl-L-homoserine triethylamine salt Chemical Properties |
| form | crystals | | Major Application | peptide synthesis | | InChIKey | LRIHVFUNJCWVBP-BOXHHOBZSA-N | | SMILES | CCN(CC)CC.OCCC(NC(c1ccccc1)(c2ccccc2)c3ccccc3)C(O)=O |
| WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| | N-Trityl-L-homoserine triethylamine salt Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Trityl-L-homoserine triethylamine salt Preparation Products And Raw materials |
|