|
|
| | N-(BOC-AMINO)PHTHALIMIDE Basic information |
| Product Name: | N-(BOC-AMINO)PHTHALIMIDE | | Synonyms: | 104188;tert-butyl N-(1,3-dioxoisoindol-2-yl)carbamate;tert-Butyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)carbamate;N-Boc-N-TCP N-(Boc-amino)phthalimide;Carbamic acid,N-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-, 1,1-dimethylethyl ester;Carbamic acid,N-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-;Nμ-Boc-N,N-phthaloylhydrazine, N-(tert-Butoxycarbonylamino)phthalimide;tert-butyl 1,3-dioxoisoindolin-2-ylcarbaMate | | CAS: | 34387-89-8 | | MF: | C13H14N2O4 | | MW: | 262.26 | | EINECS: | | | Product Categories: | | | Mol File: | 34387-89-8.mol |  |
| | N-(BOC-AMINO)PHTHALIMIDE Chemical Properties |
| Melting point | 140-145 °C | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | tetrahydrofuran: 50 mg/mL, clear, colorless | | pka | 7.46±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H14N2O4/c1-13(2,3)19-12(18)14-15-10(16)8-6-4-5-7-9(8)11(15)17/h4-7H,1-3H3,(H,14,18) | | InChIKey | IOPZBVFVFPPDSC-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NN1C(=O)C2=C(C1=O)C=CC=C2 |
| | N-(BOC-AMINO)PHTHALIMIDE Usage And Synthesis |
| Uses | N-(tert-Butoxycarbonylamino)phthalimide is a reagent used in the preparation of hydrazidomycin A analogs, which has cytotoxic and antiproliferative activity. |
| | N-(BOC-AMINO)PHTHALIMIDE Preparation Products And Raw materials |
|